C10H20ClN3O2 — CID 175944864
methyl 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride (PubChem CID 175944864) has the molecular formula C10H20ClN3O2 and a molecular weight of 249.74 g/mol. Its IUPAC name is methyl 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride.
| Compound Name | methyl 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 175944864 |
| Molecular Formula | C10H20ClN3O2 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | methyl 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CCC(CN=C(N)N)CC1.Cl |
| InChI | InChI=1S/C10H19N3O2.ClH/c1-15-9(14)8-4-2-7(3-5-8)6-13-10(11)12;/h7-8H,2-6H2,1H3,(H4,11,12,13);1H |
| InChIKey | XFQCEHLHFPQALZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|