About (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride
(3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride (PubChem CID 67635943) has the molecular formula C15H20Cl3N3O2
and a molecular weight of 380.70 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride |
| PubChem CID | 67635943 |
| Molecular Formula | C15H20Cl3N3O2 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride |
| SMILES | Cl.NC(N)=NCC1CCC(C(=O)Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H19Cl2N3O2.ClH/c16-12-6-5-11(7-13(12)17)22-14(21)10-3-1-9(2-4-10)8-20-15(18)19;/h5-7,9-10H,1-4,8H2,(H4,18,19,20);1H |
| InChIKey | CKIBDOHXSGCMRZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride?
The IUPAC name of (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride (CID 67635943) is (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride.
What is the SMILES notation for (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride?
The canonical SMILES for (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride is Cl.NC(N)=NCC1CCC(C(=O)Oc2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride?
The InChIKey is CKIBDOHXSGCMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N3O2.ClH/c16-12-6-5-11(7-13(12)17)22-14(21)10-3-1-9(2-4-10)8-20-15(18)19;/h5-7,9-10H,1-4,8H2,(H4,18,19,20);1H.
What are the key properties of (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride?
(3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride has a molecular weight of 380.70 g/mol, XLogP of 3.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate;hydrochloride is sourced from PubChem (CID 67635943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).