C31H35ClFN3O5 — CID 20745116
3-(4-fluorophenoxy)propyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate;hydrochloride (PubChem CID 20745116) has the molecular formula C31H35ClFN3O5 and a molecular weight of 584.09 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate;hydrochloride.
| Compound Name | 3-(4-fluorophenoxy)propyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 20745116 |
| Molecular Formula | C31H35ClFN3O5 |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 4-[4-[4-[(diaminomethylideneamino)methyl]cyclohexanecarbonyl]oxyphenyl]benzoate;hydrochloride |
| SMILES | Cl.NC(N)=NCC1CCC(C(=O)Oc2ccc(-c3ccc(C(=O)OCCCOc4ccc(F)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H34FN3O5.ClH/c32-26-12-16-27(17-13-26)38-18-1-19-39-29(36)24-8-6-22(7-9-24)23-10-14-28(15-11-23)40-30(37)25-4-2-21(3-5-25)20-35-31(33)34;/h6-17,21,25H,1-5,18-20H2,(H4,33,34,35);1H |
| InChIKey | JOSHRSKFZPXYIJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|