C19H29N3O2 — CID 15581523
(5-methyl-2-propan-2-ylphenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate (PubChem CID 15581523) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 15581523 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 4-[(diaminomethylideneamino)methyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)C2CCC(CN=C(N)N)CC2)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-12(2)16-9-4-13(3)10-17(16)24-18(23)15-7-5-14(6-8-15)11-22-19(20)21/h4,9-10,12,14-15H,5-8,11H2,1-3H3,(H4,20,21,22) |
| InChIKey | LEGLOAFFBLNVRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|