C16H22O4S — CID 21234298
(5-methyl-2-propan-2-ylphenyl) 2-(1,1-dioxothiolan-3-yl)acetate (PubChem CID 21234298) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 2-(1,1-dioxothiolan-3-yl)acetate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 2-(1,1-dioxothiolan-3-yl)acetate |
|---|---|
| PubChem CID | 21234298 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 2-(1,1-dioxothiolan-3-yl)acetate |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)CC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H22O4S/c1-11(2)14-5-4-12(3)8-15(14)20-16(17)9-13-6-7-21(18,19)10-13/h4-5,8,11,13H,6-7,9-10H2,1-3H3 |
| InChIKey | KFOZJWZATQUIGJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|