C13H18O4S — CID 55246678
1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanol (PubChem CID 55246678) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanol.
| Compound Name | 1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanol |
|---|---|
| PubChem CID | 55246678 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-[2-(1,1-dioxothiolan-3-yl)oxy-4-methylphenyl]ethanol |
| SMILES | Cc1ccc(C(C)O)c(OC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H18O4S/c1-9-3-4-12(10(2)14)13(7-9)17-11-5-6-18(15,16)8-11/h3-4,7,10-11,14H,5-6,8H2,1-2H3 |
| InChIKey | STPJZHZNZOQDTP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |