C12H15BrO4S — CID 102948735
(1R)-1-[4-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanol (PubChem CID 102948735) has the molecular formula C12H15BrO4S and a molecular weight of 335.22 g/mol. Its IUPAC name is (1R)-1-[4-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanol.
| Compound Name | (1R)-1-[4-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanol |
|---|---|
| PubChem CID | 102948735 |
| Molecular Formula | C12H15BrO4S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | (1R)-1-[4-bromo-2-(1,1-dioxothiolan-3-yl)oxyphenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(Br)cc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15BrO4S/c1-8(14)11-3-2-9(13)6-12(11)17-10-4-5-18(15,16)7-10/h2-3,6,8,10,14H,4-5,7H2,1H3/t8-,10?/m1/s1 |
| InChIKey | PQIJBBZZSTUQHM-HNHGDDPOSA-N |
| XLogP | 2.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |