C12H16BrNO4S — CID 102947240
4-[2-[(1S)-1-aminoethyl]-5-bromophenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 102947240) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 4-[2-[(1S)-1-aminoethyl]-5-bromophenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-[(1S)-1-aminoethyl]-5-bromophenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 102947240 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-[2-[(1S)-1-aminoethyl]-5-bromophenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | C[C@H](N)c1ccc(Br)cc1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H16BrNO4S/c1-7(14)9-3-2-8(13)4-11(9)18-12-6-19(16,17)5-10(12)15/h2-4,7,10,12,15H,5-6,14H2,1H3/t7-,10?,12?/m0/s1 |
| InChIKey | HYDMJWJLXKPTJX-SSOWJCPCSA-N |
| XLogP | 1.01 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |