C10H10F2O4S — CID 60878407
4-(2,4-difluorophenoxy)-1,1-dioxothiolan-3-ol (PubChem CID 60878407) has the molecular formula C10H10F2O4S and a molecular weight of 264.25 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(2,4-difluorophenoxy)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60878407 |
| Molecular Formula | C10H10F2O4S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Oc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C10H10F2O4S/c11-6-1-2-9(7(12)3-6)16-10-5-17(14,15)4-8(10)13/h1-3,8,10,13H,4-5H2 |
| InChIKey | YNJDREJEVJCLSU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |