About 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol
4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol (PubChem CID 60879724) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol |
| PubChem CID | 60879724 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol |
| SMILES | Cc1ccccc1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C11H14O4S/c1-8-4-2-3-5-10(8)15-11-7-16(13,14)6-9(11)12/h2-5,9,11-12H,6-7H2,1H3 |
| InChIKey | AOYUYGMOHLFCDL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol (CID 60879724) is 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol is Cc1ccccc1OC1CS(=O)(=O)CC1O.
What is the InChIKey of 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol?
The InChIKey is AOYUYGMOHLFCDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c1-8-4-2-3-5-10(8)15-11-7-16(13,14)6-9(11)12/h2-5,9,11-12H,6-7H2,1H3.
What are the key properties of 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol?
4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol has a molecular weight of 242.30 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 60879724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).