C11H14O4S — CID 60879724
4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol (PubChem CID 60879724) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60879724 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-(2-methylphenoxy)-1,1-dioxothiolan-3-ol |
| SMILES | Cc1ccccc1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C11H14O4S/c1-8-4-2-3-5-10(8)15-11-7-16(13,14)6-9(11)12/h2-5,9,11-12H,6-7H2,1H3 |
| InChIKey | AOYUYGMOHLFCDL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |