C12H15NO5S — CID 60885090
4-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 60885090) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60885090 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | C/C(=N\O)c1ccccc1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H15NO5S/c1-8(13-15)9-4-2-3-5-11(9)18-12-7-19(16,17)6-10(12)14/h2-5,10,12,14-15H,6-7H2,1H3/b13-8+ |
| InChIKey | YBHUROVJCLQWCH-MDWZMJQESA-N |
| XLogP | 0.42 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|