C12H16O6S — CID 60884886
4-[2-(hydroxymethyl)-6-methoxyphenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 60884886) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)-6-methoxyphenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-(hydroxymethyl)-6-methoxyphenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60884886 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[2-(hydroxymethyl)-6-methoxyphenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | COc1cccc(CO)c1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H16O6S/c1-17-10-4-2-3-8(5-13)12(10)18-11-7-19(15,16)6-9(11)14/h2-4,9,11,13-14H,5-7H2,1H3 |
| InChIKey | VVCRNPJFDULSSH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |