C14H20O4 — CID 60884406
2-[2-ethoxy-6-(hydroxymethyl)phenoxy]cyclopentan-1-ol (PubChem CID 60884406) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-ethoxy-6-(hydroxymethyl)phenoxy]cyclopentan-1-ol.
| Compound Name | 2-[2-ethoxy-6-(hydroxymethyl)phenoxy]cyclopentan-1-ol |
|---|---|
| PubChem CID | 60884406 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-ethoxy-6-(hydroxymethyl)phenoxy]cyclopentan-1-ol |
| SMILES | CCOc1cccc(CO)c1OC1CCCC1O |
| InChI | InChI=1S/C14H20O4/c1-2-17-13-8-3-5-10(9-15)14(13)18-12-7-4-6-11(12)16/h3,5,8,11-12,15-16H,2,4,6-7,9H2,1H3 |
| InChIKey | BHHWURQDTGDSMT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |