C13H18O2 — CID 102735342
trans-(1R,2R)-2-(2-ethylphenoxy)cyclopentan-1-ol (PubChem CID 102735342) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-ethylphenoxy)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-ethylphenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102735342 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | trans-(1R,2R)-2-(2-ethylphenoxy)cyclopentan-1-ol |
| SMILES | CCc1ccccc1O[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C13H18O2/c1-2-10-6-3-4-8-12(10)15-13-9-5-7-11(13)14/h3-4,6,8,11,13-14H,2,5,7,9H2,1H3/t11-,13-/m1/s1 |
| InChIKey | BTXHJXXUHMTDSJ-DGCLKSJQSA-N |
| XLogP | 2.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |