C12H14O3 — CID 60886689
2-(2-hydroxycyclopentyl)oxybenzaldehyde (PubChem CID 60886689) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(2-hydroxycyclopentyl)oxybenzaldehyde.
| Compound Name | 2-(2-hydroxycyclopentyl)oxybenzaldehyde |
|---|---|
| PubChem CID | 60886689 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(2-hydroxycyclopentyl)oxybenzaldehyde |
| SMILES | O=Cc1ccccc1OC1CCCC1O |
| InChI | InChI=1S/C12H14O3/c13-8-9-4-1-2-6-11(9)15-12-7-3-5-10(12)14/h1-2,4,6,8,10,12,14H,3,5,7H2 |
| InChIKey | JSKLZCPCAMXZBM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|