C13H19NO2 — CID 78936328
2-[2-[(1S)-1-aminoethyl]phenoxy]cyclopentan-1-ol (PubChem CID 78936328) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[2-[(1S)-1-aminoethyl]phenoxy]cyclopentan-1-ol.
| Compound Name | 2-[2-[(1S)-1-aminoethyl]phenoxy]cyclopentan-1-ol |
|---|---|
| PubChem CID | 78936328 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[2-[(1S)-1-aminoethyl]phenoxy]cyclopentan-1-ol |
| SMILES | C[C@H](N)c1ccccc1OC1CCCC1O |
| InChI | InChI=1S/C13H19NO2/c1-9(14)10-5-2-3-7-12(10)16-13-8-4-6-11(13)15/h2-3,5,7,9,11,13,15H,4,6,8,14H2,1H3/t9-,11?,13?/m0/s1 |
| InChIKey | BHYDQHHEQTWOSR-FJJSSXBZSA-N |
| XLogP | 2.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |