C20H28BFO4 — CID 171111814
2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]cyclohexan-1-ol (PubChem CID 171111814) has the molecular formula C20H28BFO4 and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]cyclohexan-1-ol.
| Compound Name | 2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 171111814 |
| Molecular Formula | C20H28BFO4 |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]cyclohexan-1-ol |
| SMILES | CC1(C)OB(C(F)=Cc2ccccc2OC2CCCCC2O)OC1(C)C |
| InChI | InChI=1S/C20H28BFO4/c1-19(2)20(3,4)26-21(25-19)18(22)13-14-9-5-7-11-16(14)24-17-12-8-6-10-15(17)23/h5,7,9,11,13,15,17,23H,6,8,10,12H2,1-4H3 |
| InChIKey | HKTQGYNXTDBKQS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|