C17H21BF4O3 — CID 171111428
2-[1-fluoro-2-[2-(3,3,3-trifluoropropoxy)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171111428) has the molecular formula C17H21BF4O3 and a molecular weight of 360.16 g/mol. Its IUPAC name is 2-[1-fluoro-2-[2-(3,3,3-trifluoropropoxy)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-[2-(3,3,3-trifluoropropoxy)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171111428 |
| Molecular Formula | C17H21BF4O3 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[1-fluoro-2-[2-(3,3,3-trifluoropropoxy)phenyl]ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=Cc2ccccc2OCCC(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C17H21BF4O3/c1-15(2)16(3,4)25-18(24-15)14(19)11-12-7-5-6-8-13(12)23-10-9-17(20,21)22/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | ZCBXVLGNMCQRTN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|