C15H15BF3NO2 — CID 171111222
2,6-difluoro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzonitrile (PubChem CID 171111222) has the molecular formula C15H15BF3NO2 and a molecular weight of 309.10 g/mol. Its IUPAC name is 2,6-difluoro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzonitrile.
| Compound Name | 2,6-difluoro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 171111222 |
| Molecular Formula | C15H15BF3NO2 |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2,6-difluoro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]benzonitrile |
| SMILES | CC1(C)OB(C(F)=Cc2ccc(F)c(C#N)c2F)OC1(C)C |
| InChI | InChI=1S/C15H15BF3NO2/c1-14(2)15(3,4)22-16(21-14)12(18)7-9-5-6-11(17)10(8-20)13(9)19/h5-7H,1-4H3 |
| InChIKey | BDRBKAYBIMEUTR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|