C18H22BFN2O4 — CID 171110213
4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxy-1,8-naphthyridine (PubChem CID 171110213) has the molecular formula C18H22BFN2O4 and a molecular weight of 360.19 g/mol. Its IUPAC name is 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxy-1,8-naphthyridine.
| Compound Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxy-1,8-naphthyridine |
|---|---|
| PubChem CID | 171110213 |
| Molecular Formula | C18H22BFN2O4 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxy-1,8-naphthyridine |
| SMILES | COc1ccc2c(C=C(F)B3OC(C)(C)C(C)(C)O3)cc(OC)nc2n1 |
| InChI | InChI=1S/C18H22BFN2O4/c1-17(2)18(3,4)26-19(25-17)13(20)9-11-10-15(24-6)22-16-12(11)7-8-14(21-16)23-5/h7-10H,1-6H3 |
| InChIKey | IFGMBXJBYOCZFN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|