C14H21BFNO2 — CID 171110298
3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,5-dimethyl-1H-pyrrole (PubChem CID 171110298) has the molecular formula C14H21BFNO2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,5-dimethyl-1H-pyrrole.
| Compound Name | 3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,5-dimethyl-1H-pyrrole |
|---|---|
| PubChem CID | 171110298 |
| Molecular Formula | C14H21BFNO2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,5-dimethyl-1H-pyrrole |
| SMILES | Cc1cc(C=C(F)B2OC(C)(C)C(C)(C)O2)c(C)[nH]1 |
| InChI | InChI=1S/C14H21BFNO2/c1-9-7-11(10(2)17-9)8-12(16)15-18-13(3,4)14(5,6)19-15/h7-8,17H,1-6H3 |
| InChIKey | IXFNSGCFUSODLL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|