C14H14BBr2F3O2 — CID 171111212
2-[2-(3,5-dibromo-2,6-difluorophenyl)-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171111212) has the molecular formula C14H14BBr2F3O2 and a molecular weight of 441.88 g/mol. Its IUPAC name is 2-[2-(3,5-dibromo-2,6-difluorophenyl)-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(3,5-dibromo-2,6-difluorophenyl)-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171111212 |
| Molecular Formula | C14H14BBr2F3O2 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | 2-[2-(3,5-dibromo-2,6-difluorophenyl)-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=Cc2c(F)c(Br)cc(Br)c2F)OC1(C)C |
| InChI | InChI=1S/C14H14BBr2F3O2/c1-13(2)14(3,4)22-15(21-13)10(18)5-7-11(19)8(16)6-9(17)12(7)20/h5-6H,1-4H3 |
| InChIKey | YUXFARJLZXQSDY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|