C19H23BFNO4 — CID 171110266
3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxyquinoline (PubChem CID 171110266) has the molecular formula C19H23BFNO4 and a molecular weight of 359.21 g/mol. Its IUPAC name is 3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxyquinoline.
| Compound Name | 3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 171110266 |
| Molecular Formula | C19H23BFNO4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2,7-dimethoxyquinoline |
| SMILES | COc1ccc2cc(C=C(F)B3OC(C)(C)C(C)(C)O3)c(OC)nc2c1 |
| InChI | InChI=1S/C19H23BFNO4/c1-18(2)19(3,4)26-20(25-18)16(21)10-13-9-12-7-8-14(23-5)11-15(12)22-17(13)24-6/h7-11H,1-6H3 |
| InChIKey | BBAFNDXDGMHIKI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|