C18H23BFN3O4 — CID 171110803
1-(2,5-dimethoxyphenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole (PubChem CID 171110803) has the molecular formula C18H23BFN3O4 and a molecular weight of 375.21 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole.
| Compound Name | 1-(2,5-dimethoxyphenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole |
|---|---|
| PubChem CID | 171110803 |
| Molecular Formula | C18H23BFN3O4 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]triazole |
| SMILES | COc1ccc(OC)c(-n2cc(C=C(F)B3OC(C)(C)C(C)(C)O3)nn2)c1 |
| InChI | InChI=1S/C18H23BFN3O4/c1-17(2)18(3,4)27-19(26-17)16(20)9-12-11-23(22-21-12)14-10-13(24-5)7-8-15(14)25-6/h7-11H,1-6H3 |
| InChIKey | DEGZGGIEUKPING-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|