C21H27BFN3O6 — CID 171113986
methyl 1-[2-(2,5-dimethoxyphenyl)-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylate (PubChem CID 171113986) has the molecular formula C21H27BFN3O6 and a molecular weight of 447.27 g/mol. Its IUPAC name is methyl 1-[2-(2,5-dimethoxyphenyl)-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(2,5-dimethoxyphenyl)-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 171113986 |
| Molecular Formula | C21H27BFN3O6 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | methyl 1-[2-(2,5-dimethoxyphenyl)-3-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=C(F)B2OC(C)(C)C(C)(C)O2)c2cc(OC)ccc2OC)nn1 |
| InChI | InChI=1S/C21H27BFN3O6/c1-20(2)21(3,4)32-22(31-20)18(23)15(11-26-12-16(24-25-26)19(27)30-7)14-10-13(28-5)8-9-17(14)29-6/h8-10,12H,11H2,1-7H3 |
| InChIKey | PSSSPJQPYILUEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|