C17H21N5O4 — CID 122241532
methyl 1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]triazole-4-carboxylate (PubChem CID 122241532) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is methyl 1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241532 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | methyl 1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)N2CCN(c3ccccc3OC)CC2)nn1 |
| InChI | InChI=1S/C17H21N5O4/c1-25-15-6-4-3-5-14(15)20-7-9-21(10-8-20)16(23)12-22-11-13(18-19-22)17(24)26-2/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | MZDXELZILSHHOU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |