C18H20BFN4O6 — CID 171113961
1-[3-fluoro-2-(4-nitrophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylic acid (PubChem CID 171113961) has the molecular formula C18H20BFN4O6 and a molecular weight of 418.19 g/mol. Its IUPAC name is 1-[3-fluoro-2-(4-nitrophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylic acid.
| Compound Name | 1-[3-fluoro-2-(4-nitrophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 171113961 |
| Molecular Formula | C18H20BFN4O6 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-[3-fluoro-2-(4-nitrophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]triazole-4-carboxylic acid |
| SMILES | CC1(C)OB(C(F)=C(Cn2cc(C(=O)O)nn2)c2ccc([N+](=O)[O-])cc2)OC1(C)C |
| InChI | InChI=1S/C18H20BFN4O6/c1-17(2)18(3,4)30-19(29-17)15(20)13(9-23-10-14(16(25)26)21-22-23)11-5-7-12(8-6-11)24(27)28/h5-8,10H,9H2,1-4H3,(H,25,26) |
| InChIKey | PAURWJDNRMCQCA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|