C19H27BF2O4 — CID 171113183
2-[4-ethoxy-1-fluoro-2-(5-fluoro-2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113183) has the molecular formula C19H27BF2O4 and a molecular weight of 368.23 g/mol. Its IUPAC name is 2-[4-ethoxy-1-fluoro-2-(5-fluoro-2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-ethoxy-1-fluoro-2-(5-fluoro-2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113183 |
| Molecular Formula | C19H27BF2O4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-[4-ethoxy-1-fluoro-2-(5-fluoro-2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOCCC(=C(F)B1OC(C)(C)C(C)(C)O1)c1cc(F)ccc1OC |
| InChI | InChI=1S/C19H27BF2O4/c1-7-24-11-10-14(15-12-13(21)8-9-16(15)23-6)17(22)20-25-18(2,3)19(4,5)26-20/h8-9,12H,7,10-11H2,1-6H3 |
| InChIKey | INCHBAVOTYXWQH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|