C20H27BF2O4 — CID 171113194
2-[1-fluoro-2-(3-fluoro-2-methoxyphenyl)-4-prop-2-enoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113194) has the molecular formula C20H27BF2O4 and a molecular weight of 380.24 g/mol. Its IUPAC name is 2-[1-fluoro-2-(3-fluoro-2-methoxyphenyl)-4-prop-2-enoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-(3-fluoro-2-methoxyphenyl)-4-prop-2-enoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113194 |
| Molecular Formula | C20H27BF2O4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[1-fluoro-2-(3-fluoro-2-methoxyphenyl)-4-prop-2-enoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CCOCCC(=C(F)B1OC(C)(C)C(C)(C)O1)c1cccc(F)c1OC |
| InChI | InChI=1S/C20H27BF2O4/c1-7-12-25-13-11-15(14-9-8-10-16(22)17(14)24-6)18(23)21-26-19(2,3)20(4,5)27-21/h7-10H,1,11-13H2,2-6H3 |
| InChIKey | GOEPOGHNVVSREI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|