C18H26BFO4S — CID 171114602
2-[2-(2,3-dimethoxyphenyl)-1-fluoro-3-methylsulfanylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114602) has the molecular formula C18H26BFO4S and a molecular weight of 368.28 g/mol. Its IUPAC name is 2-[2-(2,3-dimethoxyphenyl)-1-fluoro-3-methylsulfanylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(2,3-dimethoxyphenyl)-1-fluoro-3-methylsulfanylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114602 |
| Molecular Formula | C18H26BFO4S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-[2-(2,3-dimethoxyphenyl)-1-fluoro-3-methylsulfanylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1cccc(C(CSC)=C(F)B2OC(C)(C)C(C)(C)O2)c1OC |
| InChI | InChI=1S/C18H26BFO4S/c1-17(2)18(3,4)24-19(23-17)16(20)13(11-25-7)12-9-8-10-14(21-5)15(12)22-6/h8-10H,11H2,1-7H3 |
| InChIKey | FFXINWQESOUGDW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|