C22H34BFO5 — CID 171113064
2-[2-(2,3-dimethoxyphenyl)-1-fluoro-4-[(2-methylpropan-2-yl)oxy]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113064) has the molecular formula C22H34BFO5 and a molecular weight of 408.32 g/mol. Its IUPAC name is 2-[2-(2,3-dimethoxyphenyl)-1-fluoro-4-[(2-methylpropan-2-yl)oxy]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(2,3-dimethoxyphenyl)-1-fluoro-4-[(2-methylpropan-2-yl)oxy]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113064 |
| Molecular Formula | C22H34BFO5 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[2-(2,3-dimethoxyphenyl)-1-fluoro-4-[(2-methylpropan-2-yl)oxy]but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1cccc(C(CCOC(C)(C)C)=C(F)B2OC(C)(C)C(C)(C)O2)c1OC |
| InChI | InChI=1S/C22H34BFO5/c1-20(2,3)27-14-13-16(15-11-10-12-17(25-8)18(15)26-9)19(24)23-28-21(4,5)22(6,7)29-23/h10-12H,13-14H2,1-9H3 |
| InChIKey | IVQYHQUQSMSIEK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|