C21H32BFO5 — CID 171113101
2-[2-(3,5-dimethoxyphenyl)-1-fluoro-4-propoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113101) has the molecular formula C21H32BFO5 and a molecular weight of 394.29 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxyphenyl)-1-fluoro-4-propoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(3,5-dimethoxyphenyl)-1-fluoro-4-propoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113101 |
| Molecular Formula | C21H32BFO5 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[2-(3,5-dimethoxyphenyl)-1-fluoro-4-propoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCOCCC(=C(F)B1OC(C)(C)C(C)(C)O1)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C21H32BFO5/c1-8-10-26-11-9-18(15-12-16(24-6)14-17(13-15)25-7)19(23)22-27-20(2,3)21(4,5)28-22/h12-14H,8-11H2,1-7H3 |
| InChIKey | BTYZUZWKEDFZCT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|