C19H22BF3O3 — CID 171113177
2-[2-(3,4-difluorophenyl)-1-fluoro-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113177) has the molecular formula C19H22BF3O3 and a molecular weight of 366.19 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-1-fluoro-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(3,4-difluorophenyl)-1-fluoro-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113177 |
| Molecular Formula | C19H22BF3O3 |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-1-fluoro-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C#CCOCCC(=C(F)B1OC(C)(C)C(C)(C)O1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22BF3O3/c1-6-10-24-11-9-14(13-7-8-15(21)16(22)12-13)17(23)20-25-18(2,3)19(4,5)26-20/h1,7-8,12H,9-11H2,2-5H3 |
| InChIKey | YGGXIBIJHPMOKF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|