C18H24BFO4 — CID 171113245
2-[1-fluoro-2-(5-methylfuran-2-yl)-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171113245) has the molecular formula C18H24BFO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-[1-fluoro-2-(5-methylfuran-2-yl)-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-(5-methylfuran-2-yl)-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171113245 |
| Molecular Formula | C18H24BFO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[1-fluoro-2-(5-methylfuran-2-yl)-4-prop-2-ynoxybut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C#CCOCCC(=C(F)B1OC(C)(C)C(C)(C)O1)c1ccc(C)o1 |
| InChI | InChI=1S/C18H24BFO4/c1-7-11-21-12-10-14(15-9-8-13(2)22-15)16(20)19-23-17(3,4)18(5,6)24-19/h1,8-9H,10-12H2,2-6H3 |
| InChIKey | YXAQQMDAKZGTAE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|