C17H24BFO3 — CID 171114611
2-[1-fluoro-2-(2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171114611) has the molecular formula C17H24BFO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2-[1-fluoro-2-(2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-(2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171114611 |
| Molecular Formula | C17H24BFO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[1-fluoro-2-(2-methoxyphenyl)but-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC(=C(F)B1OC(C)(C)C(C)(C)O1)c1ccccc1OC |
| InChI | InChI=1S/C17H24BFO3/c1-7-12(13-10-8-9-11-14(13)20-6)15(19)18-21-16(2,3)17(4,5)22-18/h8-11H,7H2,1-6H3 |
| InChIKey | KWUMDQJDAGMCPI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|