C16H25BN2O3 — CID 170806434
2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxyaniline (PubChem CID 170806434) has the molecular formula C16H25BN2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxyaniline.
| Compound Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxyaniline |
|---|---|
| PubChem CID | 170806434 |
| Molecular Formula | C16H25BN2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-methoxyaniline |
| SMILES | COc1ccc(C=C(CN)B2OC(C)(C)C(C)(C)O2)c(N)c1 |
| InChI | InChI=1S/C16H25BN2O3/c1-15(2)16(3,4)22-17(21-15)12(10-18)8-11-6-7-13(20-5)9-14(11)19/h6-9H,10,18-19H2,1-5H3 |
| InChIKey | LOBSWONKLQSILR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|