C17H26BNO4 — CID 170806610
3-(2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170806610) has the molecular formula C17H26BNO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170806610 |
| Molecular Formula | C17H26BNO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | COc1ccc(OC)c(C=C(CN)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H26BNO4/c1-16(2)17(3,4)23-18(22-16)13(11-19)9-12-10-14(20-5)7-8-15(12)21-6/h7-10H,11,19H2,1-6H3 |
| InChIKey | FPNVFLPABPPGIJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|