C17H25BO3S — CID 170802996
3-(5-methoxy-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170802996) has the molecular formula C17H25BO3S and a molecular weight of 320.26 g/mol. Its IUPAC name is 3-(5-methoxy-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(5-methoxy-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802996 |
| Molecular Formula | C17H25BO3S |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-(5-methoxy-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | COc1ccc(C)c(C=C(CS)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H25BO3S/c1-12-7-8-15(19-6)10-13(12)9-14(11-22)18-20-16(2,3)17(4,5)21-18/h7-10,22H,11H2,1-6H3 |
| InChIKey | PTMUXVVPLZOTFJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|