C17H25BN2O4S — CID 170803850
5-methoxy-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide (PubChem CID 170803850) has the molecular formula C17H25BN2O4S and a molecular weight of 364.28 g/mol. Its IUPAC name is 5-methoxy-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide.
| Compound Name | 5-methoxy-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 170803850 |
| Molecular Formula | C17H25BN2O4S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 5-methoxy-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide |
| SMILES | COc1ccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)c(C(=O)NN)c1 |
| InChI | InChI=1S/C17H25BN2O4S/c1-16(2)17(3,4)24-18(23-16)12(10-25)8-11-6-7-13(22-5)9-14(11)15(21)20-19/h6-9,25H,10,19H2,1-5H3,(H,20,21) |
| InChIKey | UWJHSTYDTCYUQC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|