C18H24BNO5S — CID 170804077
2-[[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoyl]amino]acetic acid (PubChem CID 170804077) has the molecular formula C18H24BNO5S and a molecular weight of 377.27 g/mol. Its IUPAC name is 2-[[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 170804077 |
| Molecular Formula | C18H24BNO5S |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[[2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoyl]amino]acetic acid |
| SMILES | CC1(C)OB(C(=Cc2ccccc2C(=O)NCC(=O)O)CS)OC1(C)C |
| InChI | InChI=1S/C18H24BNO5S/c1-17(2)18(3,4)25-19(24-17)13(11-26)9-12-7-5-6-8-14(12)16(23)20-10-15(21)22/h5-9,26H,10-11H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | KQSFBEADSHOVED-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|