C17H20BF3O4S — CID 170803881
2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)benzoic acid (PubChem CID 170803881) has the molecular formula C17H20BF3O4S and a molecular weight of 388.22 g/mol. Its IUPAC name is 2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170803881 |
| Molecular Formula | C17H20BF3O4S |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-(trifluoromethyl)benzoic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(C(F)(F)F)ccc2C(=O)O)CS)OC1(C)C |
| InChI | InChI=1S/C17H20BF3O4S/c1-15(2)16(3,4)25-18(24-15)12(9-26)8-10-7-11(17(19,20)21)5-6-13(10)14(22)23/h5-8,26H,9H2,1-4H3,(H,22,23) |
| InChIKey | NZWORKLXHSMORQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|