C16H21BO6S — CID 170803541
2,4-dihydroxy-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170803541) has the molecular formula C16H21BO6S and a molecular weight of 352.22 g/mol. Its IUPAC name is 2,4-dihydroxy-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2,4-dihydroxy-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170803541 |
| Molecular Formula | C16H21BO6S |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2,4-dihydroxy-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(C(=O)O)c(O)cc2O)CS)OC1(C)C |
| InChI | InChI=1S/C16H21BO6S/c1-15(2)16(3,4)23-17(22-15)10(8-24)5-9-6-11(14(20)21)13(19)7-12(9)18/h5-7,18-19,24H,8H2,1-4H3,(H,20,21) |
| InChIKey | QMWRHTVHKULUJN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|