C15H21BO4S2 — CID 170802919
2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]acetic acid (PubChem CID 170802919) has the molecular formula C15H21BO4S2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 170802919 |
| Molecular Formula | C15H21BO4S2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]acetic acid |
| SMILES | CC1(C)OB(C(=Cc2csc(CC(=O)O)c2)CS)OC1(C)C |
| InChI | InChI=1S/C15H21BO4S2/c1-14(2)15(3,4)20-16(19-14)11(8-21)5-10-6-12(22-9-10)7-13(17)18/h5-6,9,21H,7-8H2,1-4H3,(H,17,18) |
| InChIKey | GKNUZUVZHWOZRP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|