C16H21BO4S2 — CID 170803319
(E)-3-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 170803319) has the molecular formula C16H21BO4S2 and a molecular weight of 352.29 g/mol. Its IUPAC name is (E)-3-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170803319 |
| Molecular Formula | C16H21BO4S2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (E)-3-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CC1(C)OB(C(=Cc2csc(/C=C/C(=O)O)c2)CS)OC1(C)C |
| InChI | InChI=1S/C16H21BO4S2/c1-15(2)16(3,4)21-17(20-15)12(9-22)7-11-8-13(23-10-11)5-6-14(18)19/h5-8,10,22H,9H2,1-4H3,(H,18,19)/b6-5+,12-7? |
| InChIKey | IZNFIFPYXQDTJV-QYHKEWNESA-N |
| XLogP | 3.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|