C15H22BNO2S — CID 170802559
3-(6-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170802559) has the molecular formula C15H22BNO2S and a molecular weight of 291.23 g/mol. Its IUPAC name is 3-(6-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(6-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802559 |
| Molecular Formula | C15H22BNO2S |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-(6-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | Cc1ccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C15H22BNO2S/c1-11-6-7-12(9-17-11)8-13(10-20)16-18-14(2,3)15(4,5)19-16/h6-9,20H,10H2,1-5H3 |
| InChIKey | BGIBUQFRDIGZLE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|