C17H22BF3O3S — CID 170803827
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-ene-1-thiol (PubChem CID 170803827) has the molecular formula C17H22BF3O3S and a molecular weight of 374.23 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-ene-1-thiol.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803827 |
| Molecular Formula | C17H22BF3O3S |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2ccc(OCC(F)(F)F)cc2)CS)OC1(C)C |
| InChI | InChI=1S/C17H22BF3O3S/c1-15(2)16(3,4)24-18(23-15)13(10-25)9-12-5-7-14(8-6-12)22-11-17(19,20)21/h5-9,25H,10-11H2,1-4H3 |
| InChIKey | AEDDSPLLHGRTSU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|