C17H20BF5O4 — CID 170802293
3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802293) has the molecular formula C17H20BF5O4 and a molecular weight of 394.15 g/mol. Its IUPAC name is 3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802293 |
| Molecular Formula | C17H20BF5O4 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2ccc(OC(F)(F)C(F)(F)F)cc2)CO)OC1(C)C |
| InChI | InChI=1S/C17H20BF5O4/c1-14(2)15(3,4)27-18(26-14)12(10-24)9-11-5-7-13(8-6-11)25-17(22,23)16(19,20)21/h5-9,24H,10H2,1-4H3 |
| InChIKey | QZXRGGNXILJSGM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|