C22H27BO3 — CID 170802449
3-(4-benzylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802449) has the molecular formula C22H27BO3 and a molecular weight of 350.27 g/mol. Its IUPAC name is 3-(4-benzylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(4-benzylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802449 |
| Molecular Formula | C22H27BO3 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-(4-benzylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2ccc(Cc3ccccc3)cc2)CO)OC1(C)C |
| InChI | InChI=1S/C22H27BO3/c1-21(2)22(3,4)26-23(25-21)20(16-24)15-19-12-10-18(11-13-19)14-17-8-6-5-7-9-17/h5-13,15,24H,14,16H2,1-4H3 |
| InChIKey | BKLSFXIBVURWIV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|