C23H23BO5 — CID 170802333
3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenanthrene-9,10-dione (PubChem CID 170802333) has the molecular formula C23H23BO5 and a molecular weight of 390.24 g/mol. Its IUPAC name is 3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenanthrene-9,10-dione.
| Compound Name | 3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 170802333 |
| Molecular Formula | C23H23BO5 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenanthrene-9,10-dione |
| SMILES | CC1(C)OB(C(=Cc2ccc3c(c2)-c2ccccc2C(=O)C3=O)CO)OC1(C)C |
| InChI | InChI=1S/C23H23BO5/c1-22(2)23(3,4)29-24(28-22)15(13-25)11-14-9-10-18-19(12-14)16-7-5-6-8-17(16)20(26)21(18)27/h5-12,25H,13H2,1-4H3 |
| InChIKey | JLJWKWZZRRUGKK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|