C17H20BNO5 — CID 170802105
7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione (PubChem CID 170802105) has the molecular formula C17H20BNO5 and a molecular weight of 329.16 g/mol. Its IUPAC name is 7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione.
| Compound Name | 7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 170802105 |
| Molecular Formula | C17H20BNO5 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2,3-dione |
| SMILES | CC1(C)OB(C(=Cc2cccc3c2NC(=O)C3=O)CO)OC1(C)C |
| InChI | InChI=1S/C17H20BNO5/c1-16(2)17(3,4)24-18(23-16)11(9-20)8-10-6-5-7-12-13(10)19-15(22)14(12)21/h5-8,20H,9H2,1-4H3,(H,19,21,22) |
| InChIKey | VDLKUIJCSUFLCY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|